CID 98626
24195-07-1
Structural Information
- Molecular Formula
- C8H7NO4
- SMILES
- COC(=O)C1=C(C=CC=N1)C(=O)O
- InChI
- InChI=1S/C8H7NO4/c1-13-8(12)6-5(7(10)11)3-2-4-9-6/h2-4H,1H3,(H,10,11)
- InChIKey
- OSSIORZYXTUXBL-UHFFFAOYSA-N
- Compound name
- 2-methoxycarbonylpyridine-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 182.04478 | 133.8 |
| [M+Na]+ | 204.02672 | 142.0 |
| [M-H]- | 180.03022 | 135.2 |
| [M+NH4]+ | 199.07132 | 151.6 |
| [M+K]+ | 220.00066 | 141.3 |
| [M+H-H2O]+ | 164.03476 | 127.5 |
| [M+HCOO]- | 226.03570 | 155.2 |
| [M+CH3COO]- | 240.05135 | 177.0 |
| [M+Na-2H]- | 202.01217 | 139.0 |
| [M]+ | 181.03695 | 135.4 |
| [M]- | 181.03805 | 135.4 |