CID 95680
1h-purine, 2,6-bis(methylthio)-
Structural Information
- Molecular Formula
- C7H8N4S2
- SMILES
- CSC1=NC(=NC2=C1NC=N2)SC
- InChI
- InChI=1S/C7H8N4S2/c1-12-6-4-5(9-3-8-4)10-7(11-6)13-2/h3H,1-2H3,(H,8,9,10,11)
- InChIKey
- QLBHIPFBFNPVKW-UHFFFAOYSA-N
- Compound name
- 2,6-bis(methylsulfanyl)-7H-purine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 213.02632 | 138.0 |
| [M+Na]+ | 235.00826 | 151.8 |
| [M-H]- | 211.01176 | 137.4 |
| [M+NH4]+ | 230.05286 | 155.6 |
| [M+K]+ | 250.98220 | 146.1 |
| [M+H-H2O]+ | 195.01630 | 132.3 |
| [M+HCOO]- | 257.01724 | 148.5 |
| [M+CH3COO]- | 271.03289 | 150.8 |
| [M+Na-2H]- | 232.99371 | 140.9 |
| [M]+ | 212.01849 | 142.6 |
| [M]- | 212.01959 | 142.6 |