CID 94164
Santalene
Structural Information
- Molecular Formula
- C15H24
- SMILES
- CC(=CCCC1(C2CC3C1(C3C2)C)C)C
- InChI
- InChI=1S/C15H24/c1-10(2)6-5-7-14(3)11-8-12-13(9-11)15(12,14)4/h6,11-13H,5,7-9H2,1-4H3
- InChIKey
- KWFJIXPIFLVMPM-UHFFFAOYSA-N
- Compound name
- 1,7-dimethyl-7-(4-methylpent-3-enyl)tricyclo[2.2.1.02,6]heptane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 205.19508 | 151.1 |
| [M+Na]+ | 227.17702 | 160.4 |
| [M-H]- | 203.18052 | 153.3 |
| [M+NH4]+ | 222.22162 | 178.2 |
| [M+K]+ | 243.15096 | 155.0 |
| [M+H-H2O]+ | 187.18506 | 148.8 |
| [M+HCOO]- | 249.18600 | 165.6 |
| [M+CH3COO]- | 263.20165 | 163.3 |
| [M+Na-2H]- | 225.16247 | 154.5 |
| [M]+ | 204.18725 | 159.5 |
| [M]- | 204.18835 | 159.5 |