CID 8713207
N-benzyl-4-chloro-2-hydroxybenzamide
Structural Information
- Molecular Formula
- C14H12ClNO2
- SMILES
- C1=CC=C(C=C1)CNC(=O)C2=C(C=C(C=C2)Cl)O
- InChI
- InChI=1S/C14H12ClNO2/c15-11-6-7-12(13(17)8-11)14(18)16-9-10-4-2-1-3-5-10/h1-8,17H,9H2,(H,16,18)
- InChIKey
- KSWHOOJBQKXZLQ-UHFFFAOYSA-N
- Compound name
- N-benzyl-4-chloro-2-hydroxybenzamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 262.06294 | 156.1 |
| [M+Na]+ | 284.04488 | 164.2 |
| [M-H]- | 260.04838 | 161.7 |
| [M+NH4]+ | 279.08948 | 172.8 |
| [M+K]+ | 300.01882 | 158.5 |
| [M+H-H2O]+ | 244.05292 | 149.8 |
| [M+HCOO]- | 306.05386 | 175.2 |
| [M+CH3COO]- | 320.06951 | 193.9 |
| [M+Na-2H]- | 282.03033 | 161.0 |
| [M]+ | 261.05511 | 157.2 |
| [M]- | 261.05621 | 157.2 |