CID 85648
2,6-dimethoxybenzonitrile
Structural Information
- Molecular Formula
- C9H9NO2
- SMILES
- COC1=C(C(=CC=C1)OC)C#N
- InChI
- InChI=1S/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3
- InChIKey
- XHAHKSSLDJIEDH-UHFFFAOYSA-N
- Compound name
- 2,6-dimethoxybenzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 164.07060 | 131.0 |
| [M+Na]+ | 186.05254 | 142.3 |
| [M-H]- | 162.05604 | 135.0 |
| [M+NH4]+ | 181.09714 | 150.2 |
| [M+K]+ | 202.02648 | 140.4 |
| [M+H-H2O]+ | 146.06058 | 119.2 |
| [M+HCOO]- | 208.06152 | 152.5 |
| [M+CH3COO]- | 222.07717 | 191.4 |
| [M+Na-2H]- | 184.03799 | 137.6 |
| [M]+ | 163.06277 | 129.3 |
| [M]- | 163.06387 | 129.3 |