CID 84403
(4-ethylphenyl)acetic acid
Structural Information
- Molecular Formula
- C10H12O2
- SMILES
- CCC1=CC=C(C=C1)CC(=O)O
- InChI
- InChI=1S/C10H12O2/c1-2-8-3-5-9(6-4-8)7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)
- InChIKey
- QMBLXRHXCGJOGU-UHFFFAOYSA-N
- Compound name
- 2-(4-ethylphenyl)acetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 165.09100 | 133.9 |
| [M+Na]+ | 187.07294 | 141.4 |
| [M-H]- | 163.07644 | 136.4 |
| [M+NH4]+ | 182.11754 | 154.0 |
| [M+K]+ | 203.04688 | 139.3 |
| [M+H-H2O]+ | 147.08098 | 128.6 |
| [M+HCOO]- | 209.08192 | 156.3 |
| [M+CH3COO]- | 223.09757 | 176.8 |
| [M+Na-2H]- | 185.05839 | 139.2 |
| [M]+ | 164.08317 | 134.2 |
| [M]- | 164.08427 | 134.2 |