CID 84101
Benzoic acid, p-chlorothio-, o-ethyl ester
Structural Information
- Molecular Formula
- C9H9ClOS
- SMILES
- CCOC(=S)C1=CC=C(C=C1)Cl
- InChI
- InChI=1S/C9H9ClOS/c1-2-11-9(12)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3
- InChIKey
- ZSRGLQQAHXRPJC-UHFFFAOYSA-N
- Compound name
- O-ethyl 4-chlorobenzenecarbothioate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 201.01355 | 137.6 |
| [M+Na]+ | 222.99549 | 146.9 |
| [M-H]- | 198.99899 | 141.9 |
| [M+NH4]+ | 218.04009 | 158.6 |
| [M+K]+ | 238.96943 | 142.6 |
| [M+H-H2O]+ | 183.00353 | 133.2 |
| [M+HCOO]- | 245.00447 | 151.8 |
| [M+CH3COO]- | 259.02012 | 181.5 |
| [M+Na-2H]- | 220.98094 | 140.3 |
| [M]+ | 200.00572 | 142.0 |
| [M]- | 200.00682 | 142.0 |