CID 82037
(2-chloro-3,4-dimethoxyphenyl)acetonitrile
Structural Information
- Molecular Formula
- C10H10ClNO2
- SMILES
- COC1=C(C(=C(C=C1)CC#N)Cl)OC
- InChI
- InChI=1S/C10H10ClNO2/c1-13-8-4-3-7(5-6-12)9(11)10(8)14-2/h3-4H,5H2,1-2H3
- InChIKey
- OHKWPKQYDBARHV-UHFFFAOYSA-N
- Compound name
- 2-(2-chloro-3,4-dimethoxyphenyl)acetonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 212.04729 | 140.2 |
| [M+Na]+ | 234.02923 | 152.7 |
| [M-H]- | 210.03273 | 144.2 |
| [M+NH4]+ | 229.07383 | 158.7 |
| [M+K]+ | 250.00317 | 148.7 |
| [M+H-H2O]+ | 194.03727 | 129.3 |
| [M+HCOO]- | 256.03821 | 157.3 |
| [M+CH3COO]- | 270.05386 | 198.5 |
| [M+Na-2H]- | 232.01468 | 145.3 |
| [M]+ | 211.03946 | 140.9 |
| [M]- | 211.04056 | 140.9 |