CID 81292
2-methoxybenzylamine
Structural Information
- Molecular Formula
- C8H11NO
- SMILES
- COC1=CC=CC=C1CN
- InChI
- InChI=1S/C8H11NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,6,9H2,1H3
- InChIKey
- PXJACNDVRNAFHD-UHFFFAOYSA-N
- Compound name
- (2-methoxyphenyl)methanamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 138.09134 | 126.6 |
| [M+Na]+ | 160.07328 | 134.5 |
| [M-H]- | 136.07678 | 130.1 |
| [M+NH4]+ | 155.11788 | 148.1 |
| [M+K]+ | 176.04722 | 133.0 |
| [M+H-H2O]+ | 120.08132 | 121.0 |
| [M+HCOO]- | 182.08226 | 152.2 |
| [M+CH3COO]- | 196.09791 | 175.5 |
| [M+Na-2H]- | 158.05873 | 134.0 |
| [M]+ | 137.08351 | 126.2 |
| [M]- | 137.08461 | 126.2 |