CID 79604
Styrene, alpha-nitro-
Structural Information
- Molecular Formula
- C8H7NO2
- SMILES
- C=C(C1=CC=CC=C1)[N+](=O)[O-]
- InChI
- InChI=1S/C8H7NO2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-6H,1H2
- InChIKey
- YMXDOZWKTUBYLU-UHFFFAOYSA-N
- Compound name
- 1-nitroethenylbenzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 150.05496 | 128.0 |
| [M+Na]+ | 172.03690 | 134.8 |
| [M-H]- | 148.04040 | 131.8 |
| [M+NH4]+ | 167.08150 | 148.2 |
| [M+K]+ | 188.01084 | 129.4 |
| [M+H-H2O]+ | 132.04494 | 127.2 |
| [M+HCOO]- | 194.04588 | 153.4 |
| [M+CH3COO]- | 208.06153 | 169.4 |
| [M+Na-2H]- | 170.02235 | 136.1 |
| [M]+ | 149.04713 | 125.2 |
| [M]- | 149.04823 | 125.2 |