CID 7950
1,3,5-trichlorobenzene
Structural Information
- Molecular Formula
- C6H3Cl3
- SMILES
- C1=C(C=C(C=C1Cl)Cl)Cl
- InChI
- InChI=1S/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H
- InChIKey
- XKEFYDZQGKAQCN-UHFFFAOYSA-N
- Compound name
- 1,3,5-trichlorobenzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 180.93732 | 127.7 |
| [M+Na]+ | 202.91926 | 139.1 |
| [M-H]- | 178.92276 | 130.0 |
| [M+NH4]+ | 197.96386 | 149.2 |
| [M+K]+ | 218.89320 | 133.6 |
| [M+H-H2O]+ | 162.92730 | 125.3 |
| [M+HCOO]- | 224.92824 | 137.8 |
| [M+CH3COO]- | 238.94389 | 179.3 |
| [M+Na-2H]- | 200.90471 | 133.7 |
| [M]+ | 179.92949 | 130.0 |
| [M]- | 179.93059 | 130.0 |