CID 77999
Rosiglitazone
Structural Information
- Molecular Formula
- C18H19N3O3S
- SMILES
- CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3
- InChI
- InChI=1S/C18H19N3O3S/c1-21(16-4-2-3-9-19-16)10-11-24-14-7-5-13(6-8-14)12-15-17(22)20-18(23)25-15/h2-9,15H,10-12H2,1H3,(H,20,22,23)
- InChIKey
- YASAKCUCGLMORW-UHFFFAOYSA-N
- Compound name
- 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 358.12200 | 182.5 |
| [M+Na]+ | 380.10394 | 188.8 |
| [M-H]- | 356.10744 | 189.6 |
| [M+NH4]+ | 375.14854 | 194.2 |
| [M+K]+ | 396.07788 | 183.8 |
| [M+H-H2O]+ | 340.11198 | 173.1 |
| [M+HCOO]- | 402.11292 | 198.4 |
| [M+CH3COO]- | 416.12857 | 213.2 |
| [M+Na-2H]- | 378.08939 | 181.4 |
| [M]+ | 357.11417 | 184.5 |
| [M]- | 357.11527 | 184.5 |