CID 7695
4-methoxybenzyl acetate
Structural Information
- Molecular Formula
- C10H12O3
- SMILES
- CC(=O)OCC1=CC=C(C=C1)OC
- InChI
- InChI=1S/C10H12O3/c1-8(11)13-7-9-3-5-10(12-2)6-4-9/h3-6H,7H2,1-2H3
- InChIKey
- HFNGYHHRRMSKEU-UHFFFAOYSA-N
- Compound name
- (4-methoxyphenyl)methyl acetate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 181.08592 | 136.4 |
| [M+Na]+ | 203.06786 | 144.4 |
| [M-H]- | 179.07136 | 140.4 |
| [M+NH4]+ | 198.11246 | 156.7 |
| [M+K]+ | 219.04180 | 143.8 |
| [M+H-H2O]+ | 163.07590 | 130.7 |
| [M+HCOO]- | 225.07684 | 160.7 |
| [M+CH3COO]- | 239.09249 | 180.8 |
| [M+Na-2H]- | 201.05331 | 142.3 |
| [M]+ | 180.07809 | 140.1 |
| [M]- | 180.07919 | 140.1 |