CID 74814
2-chloro-4-fluorophenol
Structural Information
- Molecular Formula
- C6H4ClFO
- SMILES
- C1=CC(=C(C=C1F)Cl)O
- InChI
- InChI=1S/C6H4ClFO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H
- InChIKey
- IGYXYGDEYHNFFT-UHFFFAOYSA-N
- Compound name
- 2-chloro-4-fluorophenol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 147.00075 | 120.3 |
| [M+Na]+ | 168.98269 | 131.3 |
| [M-H]- | 144.98619 | 122.2 |
| [M+NH4]+ | 164.02729 | 142.5 |
| [M+K]+ | 184.95663 | 127.4 |
| [M+H-H2O]+ | 128.99073 | 116.0 |
| [M+HCOO]- | 190.99167 | 139.1 |
| [M+CH3COO]- | 205.00732 | 170.5 |
| [M+Na-2H]- | 166.96814 | 127.5 |
| [M]+ | 145.99292 | 120.3 |
| [M]- | 145.99402 | 120.3 |