CID 747056
3-methyl-2-sulfanyl-3,4-dihydroquinazolin-4-one
Structural Information
- Molecular Formula
- C9H8N2OS
- SMILES
- CN1C(=O)C2=CC=CC=C2NC1=S
- InChI
- InChI=1S/C9H8N2OS/c1-11-8(12)6-4-2-3-5-7(6)10-9(11)13/h2-5H,1H3,(H,10,13)
- InChIKey
- NVINMHFLRZHVKS-UHFFFAOYSA-N
- Compound name
- 3-methyl-2-sulfanylidene-1H-quinazolin-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 193.04302 | 135.6 |
| [M+Na]+ | 215.02496 | 147.8 |
| [M-H]- | 191.02846 | 137.3 |
| [M+NH4]+ | 210.06956 | 154.2 |
| [M+K]+ | 230.99890 | 142.2 |
| [M+H-H2O]+ | 175.03300 | 129.5 |
| [M+HCOO]- | 237.03394 | 151.4 |
| [M+CH3COO]- | 251.04959 | 149.1 |
| [M+Na-2H]- | 213.01041 | 141.4 |
| [M]+ | 192.03519 | 137.0 |
| [M]- | 192.03629 | 137.0 |