CID 74325
Parapropamol
Structural Information
- Molecular Formula
- C9H11NO2
- SMILES
- CCC(=O)NC1=CC=C(C=C1)O
- InChI
- InChI=1S/C9H11NO2/c1-2-9(12)10-7-3-5-8(11)6-4-7/h3-6,11H,2H2,1H3,(H,10,12)
- InChIKey
- SSMYTAQHMUHRSK-UHFFFAOYSA-N
- Compound name
- N-(4-hydroxyphenyl)propanamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 166.08626 | 133.9 |
| [M+Na]+ | 188.06820 | 141.0 |
| [M-H]- | 164.07170 | 136.5 |
| [M+NH4]+ | 183.11280 | 153.7 |
| [M+K]+ | 204.04214 | 139.1 |
| [M+H-H2O]+ | 148.07624 | 128.3 |
| [M+HCOO]- | 210.07718 | 157.7 |
| [M+CH3COO]- | 224.09283 | 178.0 |
| [M+Na-2H]- | 186.05365 | 139.9 |
| [M]+ | 165.07843 | 133.0 |
| [M]- | 165.07953 | 133.0 |