CID 73879
Methyldiphenylphosphine
Structural Information
- Molecular Formula
- C13H13P
- SMILES
- CP(C1=CC=CC=C1)C2=CC=CC=C2
- InChI
- InChI=1S/C13H13P/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3
- InChIKey
- UJNZOIKQAUQOCN-UHFFFAOYSA-N
- Compound name
- methyl(diphenyl)phosphane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 201.08277 | 146.4 |
| [M+Na]+ | 223.06471 | 152.5 |
| [M-H]- | 199.06821 | 151.5 |
| [M+NH4]+ | 218.10931 | 165.6 |
| [M+K]+ | 239.03865 | 149.2 |
| [M+H-H2O]+ | 183.07275 | 137.0 |
| [M+HCOO]- | 245.07369 | 175.0 |
| [M+CH3COO]- | 259.08934 | 187.0 |
| [M+Na-2H]- | 221.05016 | 149.2 |
| [M]+ | 200.07494 | 145.6 |
| [M]- | 200.07604 | 145.6 |