CID 737272
5-(benzylsulfanyl)-4h-1,2,4-triazol-3-amine
Structural Information
- Molecular Formula
- C9H10N4S
- SMILES
- C1=CC=C(C=C1)CSC2=NNC(=N2)N
- InChI
- InChI=1S/C9H10N4S/c10-8-11-9(13-12-8)14-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11,12,13)
- InChIKey
- NQJATJCXKYZVEL-UHFFFAOYSA-N
- Compound name
- 3-benzylsulfanyl-1H-1,2,4-triazol-5-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 207.06990 | 141.3 |
| [M+Na]+ | 229.05184 | 150.8 |
| [M-H]- | 205.05534 | 143.1 |
| [M+NH4]+ | 224.09644 | 157.7 |
| [M+K]+ | 245.02578 | 145.5 |
| [M+H-H2O]+ | 189.05988 | 133.4 |
| [M+HCOO]- | 251.06082 | 158.3 |
| [M+CH3COO]- | 265.07647 | 153.4 |
| [M+Na-2H]- | 227.03729 | 144.6 |
| [M]+ | 206.06207 | 140.3 |
| [M]- | 206.06317 | 140.3 |