CID 729801
2,3,4,9-tetrahydro-1h-carbazole-6-carboxylic acid
Structural Information
- Molecular Formula
- C13H13NO2
- SMILES
- C1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)O
- InChI
- InChI=1S/C13H13NO2/c15-13(16)8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h5-7,14H,1-4H2,(H,15,16)
- InChIKey
- OWQQDAGRTDUORV-UHFFFAOYSA-N
- Compound name
- 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 216.10192 | 145.4 |
| [M+Na]+ | 238.08386 | 153.7 |
| [M-H]- | 214.08736 | 147.0 |
| [M+NH4]+ | 233.12846 | 165.3 |
| [M+K]+ | 254.05780 | 148.7 |
| [M+H-H2O]+ | 198.09190 | 139.5 |
| [M+HCOO]- | 260.09284 | 163.0 |
| [M+CH3COO]- | 274.10849 | 157.4 |
| [M+Na-2H]- | 236.06931 | 150.6 |
| [M]+ | 215.09409 | 142.8 |
| [M]- | 215.09519 | 142.8 |