CID 71798
Methoserpidine
Structural Information
- Molecular Formula
- C33H40N2O9
- SMILES
- CO[C@H]1[C@@H](C[C@@H]2CN3CCC4=C([C@H]3C[C@@H]2[C@@H]1C(=O)OC)NC5=C4C=C(C=C5)OC)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC
- InChI
- InChI=1S/C33H40N2O9/c1-38-19-7-8-23-22(14-19)20-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)21(18)15-24(35)29(20)34-23/h7-8,11-12,14,18,21,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,21+,24-,27-,28+,31+/m1/s1
- InChIKey
- ULBNWNUHGJLQHO-VKMIBBQISA-N
- Compound name
- methyl (1R,15S,17R,18R,19S,20S)-7,18-dimethoxy-17-(3,4,5-trimethoxybenzoyl)oxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 609.28068 | 243.9 |
| [M+Na]+ | 631.26262 | 246.1 |
| [M-H]- | 607.26612 | 248.3 |
| [M+NH4]+ | 626.30722 | 247.3 |
| [M+K]+ | 647.23656 | 244.4 |
| [M+H-H2O]+ | 591.27066 | 232.4 |
| [M+HCOO]- | 653.27160 | 247.7 |
| [M+CH3COO]- | 667.28725 | 265.0 |
| [M+Na-2H]- | 629.24807 | 238.3 |
| [M]+ | 608.27285 | 249.8 |
| [M]- | 608.27395 | 249.8 |