CID 705801
Ethyl 2-amino-4-p-tolylthiophene-3-carboxylate
Structural Information
- Molecular Formula
- C14H15NO2S
- SMILES
- CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)C)N
- InChI
- InChI=1S/C14H15NO2S/c1-3-17-14(16)12-11(8-18-13(12)15)10-6-4-9(2)5-7-10/h4-8H,3,15H2,1-2H3
- InChIKey
- GOQSMGNEJVWZIG-UHFFFAOYSA-N
- Compound name
- ethyl 2-amino-4-(4-methylphenyl)thiophene-3-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 262.08962 | 159.3 |
| [M+Na]+ | 284.07156 | 168.0 |
| [M-H]- | 260.07506 | 166.5 |
| [M+NH4]+ | 279.11616 | 178.4 |
| [M+K]+ | 300.04550 | 164.0 |
| [M+H-H2O]+ | 244.07960 | 152.9 |
| [M+HCOO]- | 306.08054 | 179.3 |
| [M+CH3COO]- | 320.09619 | 196.7 |
| [M+Na-2H]- | 282.05701 | 158.2 |
| [M]+ | 261.08179 | 162.5 |
| [M]- | 261.08289 | 162.5 |