CID 7022529
2-hydroxy-5-methoxybenzonitrile
Structural Information
- Molecular Formula
- C8H7NO2
- SMILES
- COC1=CC(=C(C=C1)O)C#N
- InChI
- InChI=1S/C8H7NO2/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4,10H,1H3
- InChIKey
- ZFKRGDMEHBTPFN-UHFFFAOYSA-N
- Compound name
- 2-hydroxy-5-methoxybenzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 150.05496 | 128.7 |
| [M+Na]+ | 172.03690 | 139.9 |
| [M-H]- | 148.04040 | 131.6 |
| [M+NH4]+ | 167.08150 | 147.8 |
| [M+K]+ | 188.01084 | 137.5 |
| [M+H-H2O]+ | 132.04494 | 117.4 |
| [M+HCOO]- | 194.04588 | 149.1 |
| [M+CH3COO]- | 208.06153 | 186.3 |
| [M+Na-2H]- | 170.02235 | 135.2 |
| [M]+ | 149.04713 | 124.9 |
| [M]- | 149.04823 | 124.9 |