CID 7019938
Tert-butyl (2r)-2-aminobutanoate
Structural Information
- Molecular Formula
- C8H17NO2
- SMILES
- CC[C@@H](C(=O)OC(C)(C)C)N
- InChI
- InChI=1S/C8H17NO2/c1-5-6(9)7(10)11-8(2,3)4/h6H,5,9H2,1-4H3/t6-/m0/s1
- InChIKey
- UZHNWSLHLJLEAZ-LURJTMIESA-N
- Compound name
- tert-butyl (2S)-2-aminobutanoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 160.13321 | 137.6 |
| [M+Na]+ | 182.11515 | 143.6 |
| [M-H]- | 158.11865 | 137.5 |
| [M+NH4]+ | 177.15975 | 158.3 |
| [M+K]+ | 198.08909 | 144.2 |
| [M+H-H2O]+ | 142.12319 | 133.2 |
| [M+HCOO]- | 204.12413 | 158.4 |
| [M+CH3COO]- | 218.13978 | 181.0 |
| [M+Na-2H]- | 180.10060 | 141.0 |
| [M]+ | 159.12538 | 138.1 |
| [M]- | 159.12648 | 138.1 |