CID 6991953
5-cyclopropyluracil
Structural Information
- Molecular Formula
- C7H8N2O2
- SMILES
- C1CC1C2=CNC(=O)NC2=O
- InChI
- InChI=1S/C7H8N2O2/c10-6-5(4-1-2-4)3-8-7(11)9-6/h3-4H,1-2H2,(H2,8,9,10,11)
- InChIKey
- KGXDLKKSLKCKNJ-UHFFFAOYSA-N
- Compound name
- 5-cyclopropyl-1H-pyrimidine-2,4-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 153.06586 | 133.7 |
| [M+Na]+ | 175.04780 | 145.5 |
| [M-H]- | 151.05130 | 136.8 |
| [M+NH4]+ | 170.09240 | 146.4 |
| [M+K]+ | 191.02174 | 140.0 |
| [M+H-H2O]+ | 135.05584 | 126.7 |
| [M+HCOO]- | 197.05678 | 154.7 |
| [M+CH3COO]- | 211.07243 | 172.7 |
| [M+Na-2H]- | 173.03325 | 140.4 |
| [M]+ | 152.05803 | 133.6 |
| [M]- | 152.05913 | 133.6 |