CID 6912813
Bu-3889v a3
Structural Information
- Molecular Formula
- C77H106O30
- SMILES
- CC1CC23C(/C=C/C=C(/C(C4C(OC5(C4=O)CC(C(=CC5(/C=C/C(C6C(OC7(C6=O)CC(C(=CC7(/C=C/C=C(/C(C8C(OC9(C8=O)CC(C(=CC9(/C=C/C(C(C2=O)C(O3)O)O)C)CO)C)O)O)\C)C)CO[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)C)O)O)C)CO)C)O)O)\C)C=C1CO[C@@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O
- InChI
- InChI=1S/C77H106O30/c1-34-12-10-14-44-20-40(32-100-69-59(90)57(88)55(86)47(30-80)102-69)36(3)21-74(44)61(92)49(65(96)104-74)45(82)15-18-72(8)25-41(28-78)38(5)23-77(72)64(95)52(68(99)107-77)54(85)35(2)13-11-17-71(7)27-43(33-101-70-60(91)58(89)56(87)48(31-81)103-70)39(6)24-75(71)62(93)50(66(97)105-75)46(83)16-19-73(9)26-42(29-79)37(4)22-76(73)63(94)51(53(34)84)67(98)106-76/h10-20,25-27,36-39,44-60,65-70,78-91,96-99H,21-24,28-33H2,1-9H3/b14-10+,17-11+,18-15+,19-16+,34-12+,35-13+/t36?,37?,38?,39?,44?,45?,46?,47-,48-,49?,50?,51?,52?,53?,54?,55+,56+,57+,58+,59-,60-,65?,66?,67?,68?,69+,70+,71?,72?,73?,74?,75?,76?,77?/m1/s1
- InChIKey
- GMWKAEHJVQAZPE-MNKRQEGKSA-N
- Compound name
- (7E,19E,21E,33E,45E,47E)-9,11,23,25,35,37,49,51-octahydroxy-4,30-bis(hydroxymethyl)-3,6,15,18,22,29,32,41,48-nonamethyl-16,42-bis[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-12,26,38,52-tetraoxanonacyclo[48.2.1.110,13.124,27.136,39.01,6.013,18.027,32.039,44]hexapentaconta-4,7,16,19,21,30,33,42,45,47-decaene-53,54,55,56-tetrone
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 1511.6842 | 351.9 |
| [M+Na]+ | 1533.6661 | 360.4 |
| [M-H]- | 1509.6696 | 356.5 |
| [M+NH4]+ | 1528.7107 | 355.6 |
| [M+K]+ | 1549.6401 | 353.5 |
| [M+H-H2O]+ | 1493.6742 | 345.3 |
| [M+HCOO]- | 1555.6751 | 354.5 |
| [M+CH3COO]- | 1569.6908 | 355.0 |
| [M+Na-2H]- | 1531.6516 | 367.7 |
| [M]+ | 1510.6764 | 360.9 |
| [M]- | 1510.6774 | 360.9 |