CID 69099
1,2,3-triaminobenzene dihydrochloride
Structural Information
- Molecular Formula
- C6H9N3
- SMILES
- C1=CC(=C(C(=C1)N)N)N
- InChI
- InChI=1S/C6H9N3/c7-4-2-1-3-5(8)6(4)9/h1-3H,7-9H2
- InChIKey
- RUOKPLVTMFHRJE-UHFFFAOYSA-N
- Compound name
- benzene-1,2,3-triamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 124.08693 | 122.6 |
| [M+Na]+ | 146.06887 | 130.7 |
| [M-H]- | 122.07237 | 125.7 |
| [M+NH4]+ | 141.11347 | 143.6 |
| [M+K]+ | 162.04281 | 128.3 |
| [M+H-H2O]+ | 106.07691 | 116.9 |
| [M+HCOO]- | 168.07785 | 149.2 |
| [M+CH3COO]- | 182.09350 | 177.4 |
| [M+Na-2H]- | 144.05432 | 128.6 |
| [M]+ | 123.07910 | 116.9 |
| [M]- | 123.08020 | 116.9 |