CID 6439891
Wf 5239
Structural Information
- Molecular Formula
- C9H9NO2
- SMILES
- C1=CC(=CC=C1/C=C\NC=O)O
- InChI
- InChI=1S/C9H9NO2/c11-7-10-6-5-8-1-3-9(12)4-2-8/h1-7,12H,(H,10,11)/b6-5-
- InChIKey
- SOUPPVGWCZENNQ-WAYWQWQTSA-N
- Compound name
- N-[(Z)-2-(4-hydroxyphenyl)ethenyl]formamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 164.07060 | 132.0 |
| [M+Na]+ | 186.05254 | 139.7 |
| [M-H]- | 162.05604 | 134.5 |
| [M+NH4]+ | 181.09714 | 151.9 |
| [M+K]+ | 202.02648 | 136.6 |
| [M+H-H2O]+ | 146.06058 | 126.4 |
| [M+HCOO]- | 208.06152 | 157.0 |
| [M+CH3COO]- | 222.07717 | 176.3 |
| [M+Na-2H]- | 184.03799 | 139.4 |
| [M]+ | 163.06277 | 131.1 |
| [M]- | 163.06387 | 131.1 |