CID 6437838
Piericidin a
Structural Information
- Molecular Formula
- C25H37NO4
- SMILES
- C/C=C(\C)/[C@@H]([C@H](C)/C=C(\C)/C=C/C/C(=C/CC1=C(C(=O)C(=C(N1)OC)OC)C)/C)O
- InChI
- InChI=1S/C25H37NO4/c1-9-18(4)22(27)19(5)15-17(3)12-10-11-16(2)13-14-21-20(6)23(28)24(29-7)25(26-21)30-8/h9-10,12-13,15,19,22,27H,11,14H2,1-8H3,(H,26,28)/b12-10+,16-13+,17-15+,18-9+/t19-,22+/m1/s1
- InChIKey
- BBLGCDSLCDDALX-LKGBESRRSA-N
- Compound name
- 2-[(2E,5E,7E,9R,10R,11E)-10-hydroxy-3,7,9,11-tetramethyltrideca-2,5,7,11-tetraenyl]-5,6-dimethoxy-3-methyl-1H-pyridin-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 416.27953 | 204.0 |
| [M+Na]+ | 438.26147 | 207.6 |
| [M-H]- | 414.26497 | 202.5 |
| [M+NH4]+ | 433.30607 | 212.3 |
| [M+K]+ | 454.23541 | 202.3 |
| [M+H-H2O]+ | 398.26951 | 196.7 |
| [M+HCOO]- | 460.27045 | 215.8 |
| [M+CH3COO]- | 474.28610 | 227.7 |
| [M+Na-2H]- | 436.24692 | 194.6 |
| [M]+ | 415.27170 | 206.9 |
| [M]- | 415.27280 | 206.9 |