CID 640605
7-nitrocoumarin
Structural Information
- Molecular Formula
- C9H5NO4
- SMILES
- C1=CC(=CC2=C1C=CC(=O)O2)[N+](=O)[O-]
- InChI
- InChI=1S/C9H5NO4/c11-9-4-2-6-1-3-7(10(12)13)5-8(6)14-9/h1-5H
- InChIKey
- XSECDQPYFOEVPU-UHFFFAOYSA-N
- Compound name
- 7-nitrochromen-2-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 192.02913 | 132.3 |
| [M+Na]+ | 214.01107 | 141.7 |
| [M-H]- | 190.01457 | 138.4 |
| [M+NH4]+ | 209.05567 | 150.9 |
| [M+K]+ | 229.98501 | 136.8 |
| [M+H-H2O]+ | 174.01911 | 130.9 |
| [M+HCOO]- | 236.02005 | 157.6 |
| [M+CH3COO]- | 250.03570 | 175.8 |
| [M+Na-2H]- | 211.99652 | 144.3 |
| [M]+ | 191.02130 | 133.5 |
| [M]- | 191.02240 | 133.5 |