CID 6359
Bromodichloromethane
Structural Information
- Molecular Formula
- CHBrCl2
- SMILES
- C(Cl)(Cl)Br
- InChI
- InChI=1S/CHBrCl2/c2-1(3)4/h1H
- InChIKey
- FMWLUWPQPKEARP-UHFFFAOYSA-N
- Compound name
- bromo(dichloro)methane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 162.87116 | 116.0 |
| [M+Na]+ | 184.85310 | 130.1 |
| [M-H]- | 160.85660 | 119.2 |
| [M+NH4]+ | 179.89770 | 141.5 |
| [M+K]+ | 200.82704 | 117.8 |
| [M+H-H2O]+ | 144.86114 | 119.6 |
| [M+HCOO]- | 206.86208 | 128.8 |
| [M+CH3COO]- | 220.87773 | 173.4 |
| [M+Na-2H]- | 182.83855 | 124.8 |
| [M]+ | 161.86333 | 135.3 |
| [M]- | 161.86443 | 135.3 |