CID 60768
Enadoline
Structural Information
- Molecular Formula
- C24H32N2O3
- SMILES
- CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)CC4=C5C=COC5=CC=C4
- InChI
- InChI=1S/C24H32N2O3/c1-25(23(27)16-18-6-4-7-22-19(18)9-15-28-22)20-8-11-24(10-5-14-29-24)17-21(20)26-12-2-3-13-26/h4,6-7,9,15,20-21H,2-3,5,8,10-14,16-17H2,1H3/t20-,21-,24-/m0/s1
- InChIKey
- JMBYBVLCYODBJQ-HFMPRLQTSA-N
- Compound name
- 2-(1-benzofuran-4-yl)-N-methyl-N-[(5R,7S,8S)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 397.24858 | 195.9 |
| [M+Na]+ | 419.23052 | 198.2 |
| [M-H]- | 395.23402 | 208.6 |
| [M+NH4]+ | 414.27512 | 210.7 |
| [M+K]+ | 435.20446 | 197.0 |
| [M+H-H2O]+ | 379.23856 | 188.5 |
| [M+HCOO]- | 441.23950 | 211.0 |
| [M+CH3COO]- | 455.25515 | 204.8 |
| [M+Na-2H]- | 417.21597 | 191.3 |
| [M]+ | 396.24075 | 192.9 |
| [M]- | 396.24185 | 192.9 |