CID 6045897
Ethyl 2-(2-oxo-3-indolinylidene)acetate
Structural Information
- Molecular Formula
- C12H11NO3
- SMILES
- CCOC(=O)/C=C\1/C2=CC=CC=C2NC1=O
- InChI
- InChI=1S/C12H11NO3/c1-2-16-11(14)7-9-8-5-3-4-6-10(8)13-12(9)15/h3-7H,2H2,1H3,(H,13,15)/b9-7-
- InChIKey
- DBCJWPPQXWNERC-CLFYSBASSA-N
- Compound name
- ethyl (2Z)-2-(2-oxo-1H-indol-3-ylidene)acetate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 218.08118 | 146.8 |
| [M+Na]+ | 240.06312 | 155.2 |
| [M-H]- | 216.06662 | 148.8 |
| [M+NH4]+ | 235.10772 | 166.3 |
| [M+K]+ | 256.03706 | 151.5 |
| [M+H-H2O]+ | 200.07116 | 140.8 |
| [M+HCOO]- | 262.07210 | 167.0 |
| [M+CH3COO]- | 276.08775 | 183.5 |
| [M+Na-2H]- | 238.04857 | 150.1 |
| [M]+ | 217.07335 | 146.7 |
| [M]- | 217.07445 | 146.7 |