CID 602320
Methyl 2-amino-3-methoxybenzoate
Structural Information
- Molecular Formula
- C9H11NO3
- SMILES
- COC1=CC=CC(=C1N)C(=O)OC
- InChI
- InChI=1S/C9H11NO3/c1-12-7-5-3-4-6(8(7)10)9(11)13-2/h3-5H,10H2,1-2H3
- InChIKey
- YJEZEMGLLFLMDF-UHFFFAOYSA-N
- Compound name
- methyl 2-amino-3-methoxybenzoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 182.08118 | 136.3 |
| [M+Na]+ | 204.06312 | 144.7 |
| [M-H]- | 180.06662 | 140.2 |
| [M+NH4]+ | 199.10772 | 156.2 |
| [M+K]+ | 220.03706 | 143.9 |
| [M+H-H2O]+ | 164.07116 | 130.4 |
| [M+HCOO]- | 226.07210 | 161.2 |
| [M+CH3COO]- | 240.08775 | 183.2 |
| [M+Na-2H]- | 202.04857 | 141.1 |
| [M]+ | 181.07335 | 138.2 |
| [M]- | 181.07445 | 138.2 |