CID 591417
Tricyclo[4.3.1.0,3,8]decan-4-one
Structural Information
- Molecular Formula
- C10H14O
- SMILES
- C1C2CC3CC1CC(=O)C3C2
- InChI
- InChI=1S/C10H14O/c11-10-5-7-1-6-2-8(3-7)9(10)4-6/h6-9H,1-5H2
- InChIKey
- BYLLPDFBHUIPKF-UHFFFAOYSA-N
- Compound name
- tricyclo[4.3.1.03,8]decan-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 151.11174 | 130.9 |
| [M+Na]+ | 173.09368 | 137.1 |
| [M-H]- | 149.09718 | 131.9 |
| [M+NH4]+ | 168.13828 | 157.4 |
| [M+K]+ | 189.06762 | 134.3 |
| [M+H-H2O]+ | 133.10172 | 126.7 |
| [M+HCOO]- | 195.10266 | 146.8 |
| [M+CH3COO]- | 209.11831 | 143.7 |
| [M+Na-2H]- | 171.07913 | 137.0 |
| [M]+ | 150.10391 | 127.9 |
| [M]- | 150.10501 | 127.9 |