CID 590710
3,4-diethyl-2-ethoxycarbonyl-5-methylpyrrole
Structural Information
- Molecular Formula
- C12H19NO2
- SMILES
- CCC1=C(NC(=C1CC)C(=O)OCC)C
- InChI
- InChI=1S/C12H19NO2/c1-5-9-8(4)13-11(10(9)6-2)12(14)15-7-3/h13H,5-7H2,1-4H3
- InChIKey
- YXAABSBFWADBRO-UHFFFAOYSA-N
- Compound name
- ethyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 210.14887 | 148.9 |
| [M+Na]+ | 232.13081 | 157.4 |
| [M-H]- | 208.13431 | 150.2 |
| [M+NH4]+ | 227.17541 | 168.4 |
| [M+K]+ | 248.10475 | 154.8 |
| [M+H-H2O]+ | 192.13885 | 143.1 |
| [M+HCOO]- | 254.13979 | 170.0 |
| [M+CH3COO]- | 268.15544 | 187.2 |
| [M+Na-2H]- | 230.11626 | 149.4 |
| [M]+ | 209.14104 | 151.8 |
| [M]- | 209.14214 | 151.8 |