CID 589802
5-(propan-2-yl)-1h-indole-2,3-dione
Structural Information
- Molecular Formula
- C11H11NO2
- SMILES
- CC(C)C1=CC2=C(C=C1)NC(=O)C2=O
- InChI
- InChI=1S/C11H11NO2/c1-6(2)7-3-4-9-8(5-7)10(13)11(14)12-9/h3-6H,1-2H3,(H,12,13,14)
- InChIKey
- LFNQRSQKXQFHDB-UHFFFAOYSA-N
- Compound name
- 5-propan-2-yl-1H-indole-2,3-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 190.08626 | 139.4 |
| [M+Na]+ | 212.06820 | 149.0 |
| [M-H]- | 188.07170 | 141.9 |
| [M+NH4]+ | 207.11280 | 160.4 |
| [M+K]+ | 228.04214 | 145.5 |
| [M+H-H2O]+ | 172.07624 | 134.1 |
| [M+HCOO]- | 234.07718 | 159.6 |
| [M+CH3COO]- | 248.09283 | 181.8 |
| [M+Na-2H]- | 210.05365 | 142.6 |
| [M]+ | 189.07843 | 138.9 |
| [M]- | 189.07953 | 138.9 |