CID 587210
            
    3,4-dimethyl-1h-pyrrole-2-carboxylic acid
Structural Information
- Molecular Formula
- C7H9NO2
- SMILES
- CC1=CNC(=C1C)C(=O)O
- InChI
- InChI=1S/C7H9NO2/c1-4-3-8-6(5(4)2)7(9)10/h3,8H,1-2H3,(H,9,10)
- InChIKey
- IEOJTKFLLYADNV-UHFFFAOYSA-N
- Compound name
- 3,4-dimethyl-1H-pyrrole-2-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) | 
|---|---|---|
| [M+H]+ | 140.07060 | 127.1 | 
| [M+Na]+ | 162.05254 | 136.3 | 
| [M-H]- | 138.05604 | 127.5 | 
| [M+NH4]+ | 157.09714 | 148.3 | 
| [M+K]+ | 178.02648 | 134.1 | 
| [M+H-H2O]+ | 122.06058 | 122.2 | 
| [M+HCOO]- | 184.06152 | 148.4 | 
| [M+CH3COO]- | 198.07717 | 169.0 | 
| [M+Na-2H]- | 160.03799 | 130.5 | 
| [M]+ | 139.06277 | 126.0 | 
| [M]- | 139.06387 | 126.0 |