CID 58261078
1,3-dibromo-5-(2-ethylhexyl)-4h-thieno[3,4-c]pyrrole-4,6(5h)-dione
Structural Information
- Molecular Formula
- C14H17Br2NO2S
- SMILES
- CCCCC(CC)CN1C(=O)C2=C(SC(=C2C1=O)Br)Br
- InChI
- InChI=1S/C14H17Br2NO2S/c1-3-5-6-8(4-2)7-17-13(18)9-10(14(17)19)12(16)20-11(9)15/h8H,3-7H2,1-2H3
- InChIKey
- AOZLCBYWDXFKCJ-UHFFFAOYSA-N
- Compound name
- 1,3-dibromo-5-(2-ethylhexyl)thieno[3,4-c]pyrrole-4,6-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 421.94198 | 165.2 |
| [M+Na]+ | 443.92392 | 178.2 |
| [M-H]- | 419.92742 | 172.5 |
| [M+NH4]+ | 438.96852 | 184.7 |
| [M+K]+ | 459.89786 | 162.2 |
| [M+H-H2O]+ | 403.93196 | 174.1 |
| [M+HCOO]- | 465.93290 | 175.8 |
| [M+CH3COO]- | 479.94855 | 221.1 |
| [M+Na-2H]- | 441.90937 | 164.8 |
| [M]+ | 420.93415 | 203.7 |
| [M]- | 420.93525 | 203.7 |