CID 54681328
Schembl6965151
Structural Information
- Molecular Formula
- C27H24O4S
- SMILES
- CC(C)C1=CC=CC=C1SC2=C(C=C(OC2=O)C3=CC=C(C=C3)OCC4=CC=CC=C4)O
- InChI
- InChI=1S/C27H24O4S/c1-18(2)22-10-6-7-11-25(22)32-26-23(28)16-24(31-27(26)29)20-12-14-21(15-13-20)30-17-19-8-4-3-5-9-19/h3-16,18,28H,17H2,1-2H3
- InChIKey
- UXXTTWGQBUQERX-UHFFFAOYSA-N
- Compound name
- 4-hydroxy-6-(4-phenylmethoxyphenyl)-3-(2-propan-2-ylphenyl)sulfanylpyran-2-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 445.14681 | 208.4 |
| [M+Na]+ | 467.12875 | 215.6 |
| [M-H]- | 443.13225 | 220.6 |
| [M+NH4]+ | 462.17335 | 215.5 |
| [M+K]+ | 483.10269 | 210.2 |
| [M+H-H2O]+ | 427.13679 | 197.6 |
| [M+HCOO]- | 489.13773 | 223.5 |
| [M+CH3COO]- | 503.15338 | 217.3 |
| [M+Na-2H]- | 465.11420 | 207.7 |
| [M]+ | 444.13898 | 213.4 |
| [M]- | 444.14008 | 213.4 |