CID 543354
Undec-10-en-1-yl acrylate
Structural Information
- Molecular Formula
- C14H24O2
- SMILES
- C=CCCCCCCCCCOC(=O)C=C
- InChI
- InChI=1S/C14H24O2/c1-3-5-6-7-8-9-10-11-12-13-16-14(15)4-2/h3-4H,1-2,5-13H2
- InChIKey
- YXTYHLWOJXBERN-UHFFFAOYSA-N
- Compound name
- undec-10-enyl prop-2-enoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 225.18491 | 157.4 |
| [M+Na]+ | 247.16685 | 162.1 |
| [M-H]- | 223.17035 | 156.4 |
| [M+NH4]+ | 242.21145 | 175.8 |
| [M+K]+ | 263.14079 | 159.4 |
| [M+H-H2O]+ | 207.17489 | 151.7 |
| [M+HCOO]- | 269.17583 | 178.7 |
| [M+CH3COO]- | 283.19148 | 192.8 |
| [M+Na-2H]- | 245.15230 | 159.1 |
| [M]+ | 224.17708 | 161.9 |
| [M]- | 224.17818 | 161.9 |