CID 5360001
4-(hydroxyamino)quinoline n-oxide
Structural Information
- Molecular Formula
- C9H8N2O2
- SMILES
- C1=CC=C2C(=C1)/C(=N/O)/C=CN2O
- InChI
- InChI=1S/C9H8N2O2/c12-10-8-5-6-11(13)9-4-2-1-3-7(8)9/h1-6,12-13H/b10-8+
- InChIKey
- KCGKBOFRVKLKOO-CSKARUKUSA-N
- Compound name
- (NE)-N-(1-hydroxyquinolin-4-ylidene)hydroxylamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 177.06586 | 132.1 |
| [M+Na]+ | 199.04780 | 141.9 |
| [M-H]- | 175.05130 | 134.8 |
| [M+NH4]+ | 194.09240 | 151.4 |
| [M+K]+ | 215.02174 | 138.5 |
| [M+H-H2O]+ | 159.05584 | 125.6 |
| [M+HCOO]- | 221.05678 | 155.5 |
| [M+CH3COO]- | 235.07243 | 178.6 |
| [M+Na-2H]- | 197.03325 | 142.2 |
| [M]+ | 176.05803 | 131.7 |
| [M]- | 176.05913 | 131.7 |