CID 5327160
2-(2,6-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid
Structural Information
- Molecular Formula
- C14H7Cl2NO3
- SMILES
- C1=CC(=C(C(=C1)Cl)C2=NC3=C(O2)C=C(C=C3)C(=O)O)Cl
- InChI
- InChI=1S/C14H7Cl2NO3/c15-8-2-1-3-9(16)12(8)13-17-10-5-4-7(14(18)19)6-11(10)20-13/h1-6H,(H,18,19)
- InChIKey
- XVNRKPCHMYOPPL-UHFFFAOYSA-N
- Compound name
- 2-(2,6-dichlorophenyl)-1,3-benzoxazole-6-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 307.98758 | 162.4 |
| [M+Na]+ | 329.96952 | 175.6 |
| [M-H]- | 305.97302 | 168.9 |
| [M+NH4]+ | 325.01412 | 178.6 |
| [M+K]+ | 345.94346 | 169.9 |
| [M+H-H2O]+ | 289.97756 | 156.7 |
| [M+HCOO]- | 351.97850 | 175.0 |
| [M+CH3COO]- | 365.99415 | 175.5 |
| [M+Na-2H]- | 327.95497 | 166.7 |
| [M]+ | 306.97975 | 169.8 |
| [M]- | 306.98085 | 169.8 |