CID 5316205
(-)-alpha-cuprenene
Structural Information
- Molecular Formula
- C15H24
- SMILES
- CC1=CC=C(CC1)[C@]2(CCCC2(C)C)C
- InChI
- InChI=1S/C15H24/c1-12-6-8-13(9-7-12)15(4)11-5-10-14(15,2)3/h6,8H,5,7,9-11H2,1-4H3/t15-/m1/s1
- InChIKey
- DYQFFTPJVWEYMH-OAHLLOKOSA-N
- Compound name
- 1-methyl-4-[(1S)-1,2,2-trimethylcyclopentyl]cyclohexa-1,3-diene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 205.19508 | 147.7 |
| [M+Na]+ | 227.17702 | 154.8 |
| [M-H]- | 203.18052 | 154.5 |
| [M+NH4]+ | 222.22162 | 172.9 |
| [M+K]+ | 243.15096 | 151.8 |
| [M+H-H2O]+ | 187.18506 | 142.8 |
| [M+HCOO]- | 249.18600 | 168.4 |
| [M+CH3COO]- | 263.20165 | 187.7 |
| [M+Na-2H]- | 225.16247 | 150.8 |
| [M]+ | 204.18725 | 145.1 |
| [M]- | 204.18835 | 145.1 |