CID 530816
Alpha-bourbonene
Structural Information
- Molecular Formula
- C15H24
- SMILES
- CC1=CCC2C1C3C2(CCC3C(C)C)C
- InChI
- InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)13(12)14(11)15/h5,9,11-14H,6-8H2,1-4H3
- InChIKey
- FAIMMSRDTUMTQR-UHFFFAOYSA-N
- Compound name
- 3,7-dimethyl-10-propan-2-yltricyclo[5.3.0.02,6]dec-3-ene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 205.19508 | 151.2 |
| [M+Na]+ | 227.17702 | 158.0 |
| [M-H]- | 203.18052 | 156.9 |
| [M+NH4]+ | 222.22162 | 172.0 |
| [M+K]+ | 243.15096 | 157.0 |
| [M+H-H2O]+ | 187.18506 | 143.9 |
| [M+HCOO]- | 249.18600 | 169.2 |
| [M+CH3COO]- | 263.20165 | 194.6 |
| [M+Na-2H]- | 225.16247 | 151.3 |
| [M]+ | 204.18725 | 159.6 |
| [M]- | 204.18835 | 159.6 |