CID 52919
Haloperidol decanoate
Structural Information
- Molecular Formula
- C31H41ClFNO3
- SMILES
- CCCCCCCCCC(=O)OC1(CCN(CC1)CCCC(=O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)Cl
- InChI
- InChI=1S/C31H41ClFNO3/c1-2-3-4-5-6-7-8-11-30(36)37-31(26-14-16-27(32)17-15-26)20-23-34(24-21-31)22-9-10-29(35)25-12-18-28(33)19-13-25/h12-19H,2-11,20-24H2,1H3
- InChIKey
- GUTXTARXLVFHDK-UHFFFAOYSA-N
- Compound name
- [4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 530.28318 | 233.3 |
| [M+Na]+ | 552.26512 | 234.8 |
| [M-H]- | 528.26862 | 237.2 |
| [M+NH4]+ | 547.30972 | 239.4 |
| [M+K]+ | 568.23906 | 227.0 |
| [M+H-H2O]+ | 512.27316 | 221.0 |
| [M+HCOO]- | 574.27410 | 240.8 |
| [M+CH3COO]- | 588.28975 | 246.0 |
| [M+Na-2H]- | 550.25057 | 227.5 |
| [M]+ | 529.27535 | 235.9 |
| [M]- | 529.27645 | 235.9 |