CID 514858
Benzonitrile, 4-(3,4-dichlorophenoxy)-
Structural Information
- Molecular Formula
- C13H7Cl2NO
- SMILES
- C1=CC(=CC=C1C#N)OC2=CC(=C(C=C2)Cl)Cl
- InChI
- InChI=1S/C13H7Cl2NO/c14-12-6-5-11(7-13(12)15)17-10-3-1-9(8-16)2-4-10/h1-7H
- InChIKey
- LLSPXRMMNOLEGP-UHFFFAOYSA-N
- Compound name
- 4-(3,4-dichlorophenoxy)benzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 263.99776 | 156.1 |
| [M+Na]+ | 285.97970 | 169.7 |
| [M-H]- | 261.98320 | 161.5 |
| [M+NH4]+ | 281.02430 | 172.6 |
| [M+K]+ | 301.95364 | 161.4 |
| [M+H-H2O]+ | 245.98774 | 144.6 |
| [M+HCOO]- | 307.98868 | 168.6 |
| [M+CH3COO]- | 322.00433 | 167.8 |
| [M+Na-2H]- | 283.96515 | 160.6 |
| [M]+ | 262.98993 | 155.3 |
| [M]- | 262.99103 | 155.3 |