CID 511845
Benzoyl chloride, 2-(chloroseleno)-
Structural Information
- Molecular Formula
- C7H4Cl2OSe
- SMILES
- C1=CC=C(C(=C1)C(=O)Cl)[Se]Cl
- InChI
- InChI=1S/C7H4Cl2OSe/c8-7(10)5-3-1-2-4-6(5)11-9/h1-4H
- InChIKey
- DRUYRXYUOIXCBT-UHFFFAOYSA-N
- Compound name
- (2-carbonochloridoylphenyl) selenohypochlorite
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 254.88773 | 144.2 |
| [M+Na]+ | 276.86967 | 153.7 |
| [M-H]- | 252.87317 | 146.9 |
| [M+NH4]+ | 271.91427 | 164.6 |
| [M+K]+ | 292.84361 | 148.5 |
| [M+H-H2O]+ | 236.87771 | 140.0 |
| [M+HCOO]- | 298.87865 | 158.2 |
| [M+CH3COO]- | 312.89430 | 182.4 |
| [M+Na-2H]- | 274.85512 | 148.7 |
| [M]+ | 253.87990 | 147.3 |
| [M]- | 253.88100 | 147.3 |