CID 509556
Chembl567456
Structural Information
- Molecular Formula
- C22H21N5O
- SMILES
- C1=CC=NC(=C1)COC2=CC=C(C=C2)CCNC3=NC=NC4=C3C=C(C=C4)N
- InChI
- InChI=1S/C22H21N5O/c23-17-6-9-21-20(13-17)22(27-15-26-21)25-12-10-16-4-7-19(8-5-16)28-14-18-3-1-2-11-24-18/h1-9,11,13,15H,10,12,14,23H2,(H,25,26,27)
- InChIKey
- DTUFTDPBRNAGSL-UHFFFAOYSA-N
- Compound name
- 4-N-[2-[4-(pyridin-2-ylmethoxy)phenyl]ethyl]quinazoline-4,6-diamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 372.18190 | 188.6 |
| [M+Na]+ | 394.16384 | 195.1 |
| [M-H]- | 370.16734 | 194.2 |
| [M+NH4]+ | 389.20844 | 196.0 |
| [M+K]+ | 410.13778 | 187.3 |
| [M+H-H2O]+ | 354.17188 | 175.7 |
| [M+HCOO]- | 416.17282 | 208.5 |
| [M+CH3COO]- | 430.18847 | 196.9 |
| [M+Na-2H]- | 392.14929 | 196.5 |
| [M]+ | 371.17407 | 187.9 |
| [M]- | 371.17517 | 187.9 |