CID 490266
Schembl9699063
Structural Information
- Molecular Formula
- C17H17N3O5
- SMILES
- C1=CC=C(C=C1)C#CC2=C(N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)C(=O)N
- InChI
- InChI=1S/C17H17N3O5/c18-16(24)13-11(7-6-10-4-2-1-3-5-10)20(9-19-13)17-15(23)14(22)12(8-21)25-17/h1-5,9,12,14-15,17,21-23H,8H2,(H2,18,24)/t12-,14-,15-,17-/m1/s1
- InChIKey
- FBWYQTFVFJWJER-DNNBLBMLSA-N
- Compound name
- 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-phenylethynyl)imidazole-4-carboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 344.12410 | 179.9 |
| [M+Na]+ | 366.10604 | 188.3 |
| [M-H]- | 342.10954 | 181.1 |
| [M+NH4]+ | 361.15064 | 188.3 |
| [M+K]+ | 382.07998 | 182.7 |
| [M+H-H2O]+ | 326.11408 | 165.5 |
| [M+HCOO]- | 388.11502 | 190.2 |
| [M+CH3COO]- | 402.13067 | 210.4 |
| [M+Na-2H]- | 364.09149 | 175.2 |
| [M]+ | 343.11627 | 172.0 |
| [M]- | 343.11737 | 172.0 |