CID 476078
Gs 8370
Structural Information
- Molecular Formula
- C11H17N6O4P
- SMILES
- C=CCNC1=C2C(=NC(=N1)N)N(C=N2)CCOCP(=O)(O)O
- InChI
- InChI=1S/C11H17N6O4P/c1-2-3-13-9-8-10(16-11(12)15-9)17(6-14-8)4-5-21-7-22(18,19)20/h2,6H,1,3-5,7H2,(H2,18,19,20)(H3,12,13,15,16)
- InChIKey
- PYZAHYOBFDEFSC-UHFFFAOYSA-N
- Compound name
- 2-[2-amino-6-(prop-2-enylamino)purin-9-yl]ethoxymethylphosphonic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 329.11218 | 174.0 |
| [M+Na]+ | 351.09412 | 181.5 |
| [M-H]- | 327.09762 | 170.0 |
| [M+NH4]+ | 346.13872 | 183.7 |
| [M+K]+ | 367.06806 | 178.0 |
| [M+H-H2O]+ | 311.10216 | 163.0 |
| [M+HCOO]- | 373.10310 | 197.1 |
| [M+CH3COO]- | 387.11875 | 208.4 |
| [M+Na-2H]- | 349.07957 | 177.1 |
| [M]+ | 328.10435 | 176.6 |
| [M]- | 328.10545 | 176.6 |